6-azido-1,2,3,4-tetrahydronaphthalene structure
|
Common Name | 6-azido-1,2,3,4-tetrahydronaphthalene | ||
|---|---|---|---|---|
| CAS Number | 117103-54-5 | Molecular Weight | 173.21400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H11N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-azido-1,2,3,4-tetrahydronaphthalene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H11N3 |
|---|---|
| Molecular Weight | 173.21400 |
| Exact Mass | 173.09500 |
| PSA | 49.75000 |
| LogP | 2.95996 |
| InChIKey | LJBIYTMVXKOVTK-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=Nc1ccc2c(c1)CCCC2 |
|
~%
6-azido-1,2,3,4... CAS#:117103-54-5 |
| Literature: Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), , p. 1933 - 1938 |
|
~%
6-azido-1,2,3,4... CAS#:117103-54-5 |
| Literature: Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), , p. 1933 - 1938 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Naphthalene,6-azido-1,2,3,4-tetrahydro |