1,3-Dimethyl 5-[[2-(4-fluorophenoxy)-1-oxobutyl]amino]-1,3-benzenedicarboxylate
Modify Date: 2025-09-28 16:30:43
![1,3-Dimethyl 5-[[2-(4-fluorophenoxy)-1-oxobutyl]amino]-1,3-benzenedicarboxylate Structure](https://www.chemsrc.com/extcaspic/030/1171069-09-2.png)
1,3-Dimethyl 5-[[2-(4-fluorophenoxy)-1-oxobutyl]amino]-1,3-benzenedicarboxylate structure
|
Common Name | 1,3-Dimethyl 5-[[2-(4-fluorophenoxy)-1-oxobutyl]amino]-1,3-benzenedicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 1171069-09-2 | Molecular Weight | 389.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H20FNO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,3-Dimethyl 5-[[2-(4-fluorophenoxy)-1-oxobutyl]amino]-1,3-benzenedicarboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H20FNO6 |
|---|---|
| Molecular Weight | 389.4 |
| InChIKey | UEHXZNWSJICZIH-UHFFFAOYSA-N |
| SMILES | CCC(Oc1ccc(F)cc1)C(=O)Nc1cc(C(=O)OC)cc(C(=O)OC)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 1,3-Dimethyl 5-[[2-(4-fluorophenoxy)-1-oxobutyl]amino]-1,3-benzenedicarboxylate? |
| A: Molecular weight of 1,3-Dimethyl 5-[[2-(4-fluorophenoxy)-1-oxobutyl]amino]-1,3-benzenedicarboxylate is 389.4. |
| Q: What is the English name of 1,3-Dimethyl 5-[[2-(4-fluorophenoxy)-1-oxobutyl]amino]-1,3-benzenedicarboxylate? |
| A: The English name of 1,3-Dimethyl 5-[[2-(4-fluorophenoxy)-1-oxobutyl]amino]-1,3-benzenedicarboxylate is 1,3-Dimethyl 5-[[2-(4-fluorophenoxy)-1-oxobutyl]amino]-1,3-benzenedicarboxylate. |
| Q: What is the SMILES notation of 1,3-Dimethyl 5-[[2-(4-fluorophenoxy)-1-oxobutyl]amino]-1,3-benzenedicarboxylate? |
| A: SMILES notation of 1,3-Dimethyl 5-[[2-(4-fluorophenoxy)-1-oxobutyl]amino]-1,3-benzenedicarboxylate is CCC(Oc1ccc(F)cc1)C(=O)Nc1cc(C(=O)OC)cc(C(=O)OC)c1. |
| Q: What is the InChIKey of 1,3-Dimethyl 5-[[2-(4-fluorophenoxy)-1-oxobutyl]amino]-1,3-benzenedicarboxylate? |
| A: InChIKey of 1,3-Dimethyl 5-[[2-(4-fluorophenoxy)-1-oxobutyl]amino]-1,3-benzenedicarboxylate is UEHXZNWSJICZIH-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1171069-09-2? |
| A: Chinese name of 1171069-09-2 is 1171069-09-2. |
| Q: What is the CAS number of 1,3-Dimethyl 5-[[2-(4-fluorophenoxy)-1-oxobutyl]amino]-1,3-benzenedicarboxylate? |
| A: CAS number of 1,3-Dimethyl 5-[[2-(4-fluorophenoxy)-1-oxobutyl]amino]-1,3-benzenedicarboxylate is 1171069-09-2. |
| Q: What is the molecular formula of 1,3-Dimethyl 5-[[2-(4-fluorophenoxy)-1-oxobutyl]amino]-1,3-benzenedicarboxylate? |
| A: Molecular formula of 1,3-Dimethyl 5-[[2-(4-fluorophenoxy)-1-oxobutyl]amino]-1,3-benzenedicarboxylate is C20H20FNO6. |