2-[[bis(2-chloroethyl)amino-(cyclohexylamino)phosphoryl]amino]ethanol structure
|
Common Name | 2-[[bis(2-chloroethyl)amino-(cyclohexylamino)phosphoryl]amino]ethanol | ||
|---|---|---|---|---|
| CAS Number | 117112-33-1 | Molecular Weight | 346.23400 | |
| Density | 1.25g/cm3 | Boiling Point | 466.6ºC at 760 mmHg | |
| Molecular Formula | C12H26Cl2N3O2P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 236ºC | |
| Name | 2-[[bis(2-chloroethyl)amino-(cyclohexylamino)phosphoryl]amino]ethanol |
|---|
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 466.6ºC at 760 mmHg |
| Molecular Formula | C12H26Cl2N3O2P |
| Molecular Weight | 346.23400 |
| Flash Point | 236ºC |
| Exact Mass | 345.11400 |
| PSA | 74.41000 |
| LogP | 3.16010 |
| Vapour Pressure | 1.14E-10mmHg at 25°C |
| Index of Refraction | 1.523 |
| InChIKey | HGQCIGLUITYMKL-UHFFFAOYSA-N |
| SMILES | O=P(NCCO)(NC1CCCCC1)N(CCCl)CCCl |
|
~%
2-[[bis(2-chlor... CAS#:117112-33-1 |
| Literature: Bulletin of the Academy of Sciences of the USSR, Division of Chemical Science (English Translation), , vol. 36, # 9 p. 1896 - 1899 Izvestiya Akademii Nauk SSSR, Seriya Khimicheskaya, , # 9 p. 2045 - 2049 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |