2-(6,11-dihydrobenzo[c][1]benzothiepin-11-ylamino)propanamide structure
|
Common Name | 2-(6,11-dihydrobenzo[c][1]benzothiepin-11-ylamino)propanamide | ||
|---|---|---|---|---|
| CAS Number | 117125-45-8 | Molecular Weight | 298.40300 | |
| Density | 1.26g/cm3 | Boiling Point | 496.5ºC at 760 mmHg | |
| Molecular Formula | C17H18N2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 254.1ºC | |
| Name | 2-(6,11-dihydrobenzo[c][1]benzothiepin-11-ylamino)propanamide |
|---|
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 496.5ºC at 760 mmHg |
| Molecular Formula | C17H18N2OS |
| Molecular Weight | 298.40300 |
| Flash Point | 254.1ºC |
| Exact Mass | 298.11400 |
| PSA | 81.41000 |
| LogP | 4.38570 |
| Vapour Pressure | 5.39E-10mmHg at 25°C |
| Index of Refraction | 1.667 |
| InChIKey | KECYVVXOYVPSJP-UHFFFAOYSA-N |
| SMILES | CC(NC1c2ccccc2CSc2ccccc21)C(N)=O |
|
~80%
2-(6,11-dihydro... CAS#:117125-45-8 |
| Literature: Valenta, Vladimir; Hulinska, Hana; Holubek, Jiri; Dlabac, Antonin; Metys, Jan; et al. Collection of Czechoslovak Chemical Communications, 1988 , vol. 53, # 4 p. 860 - 869 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |