ethyl 1-hydroxy-6-nitrobenzimidazole-2-carboxylate structure
|
Common Name | ethyl 1-hydroxy-6-nitrobenzimidazole-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 117131-20-1 | Molecular Weight | 251.19600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H9N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 1-hydroxy-6-nitrobenzimidazole-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H9N3O5 |
|---|---|
| Molecular Weight | 251.19600 |
| Exact Mass | 251.05400 |
| PSA | 110.17000 |
| LogP | 1.88170 |
| InChIKey | FCNBKJFFFMDAHV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1nc2ccc([N+](=O)[O-])cc2n1O |
|
~54%
ethyl 1-hydroxy... CAS#:117131-20-1 |
| Literature: Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), , p. 681 - 690 |
|
~%
ethyl 1-hydroxy... CAS#:117131-20-1 |
| Literature: Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), , p. 681 - 690 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 1H-Benzimidazole-2-carboxylic acid,5-nitro-,ethyl ester,3-oxide |
| ethyl 5-nitro-1H-benzimidazole-2-carboxylate 3-oxide |