S-[(4R,4aR,7R,7aR,12bS)-9-hydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-7-yl] ethanethioate structure
|
Common Name | S-[(4R,4aR,7R,7aR,12bS)-9-hydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-7-yl] ethanethioate | ||
|---|---|---|---|---|
| CAS Number | 117152-64-4 | Molecular Weight | 343.44000 | |
| Density | 1.41g/cm3 | Boiling Point | 506.9ºC at 760mmHg | |
| Molecular Formula | C19H21NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 260.3ºC | |
| Name | S-[(4R,4aR,7R,7aR,12bS)-9-hydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-7-yl] ethanethioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.41g/cm3 |
|---|---|
| Boiling Point | 506.9ºC at 760mmHg |
| Molecular Formula | C19H21NO3S |
| Molecular Weight | 343.44000 |
| Flash Point | 260.3ºC |
| Exact Mass | 343.12400 |
| PSA | 75.07000 |
| LogP | 2.42340 |
| Vapour Pressure | 6.77E-11mmHg at 25°C |
| Index of Refraction | 1.697 |
| InChIKey | IQAOQEHSVLTFRY-MKUCUKIISA-N |
| SMILES | CC(=O)SC1C=CC2C3Cc4ccc(O)c5c4C2(CCN3C)C1O5 |
|
~71%
S-[(4R,4aR,7R,7... CAS#:117152-64-4 |
| Literature: Fujii; Togame; Yamamoto; Kanematsu; Takayanagi; Konno Chemical and Pharmaceutical Bulletin, 1988 , vol. 36, # 6 p. 2282 - 2285 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 6-Acetylthiomorphine |
| KT 88 |