8-Chloronaphthalene-1-sulfonic acid dihydrate structure
|
Common Name | 8-Chloronaphthalene-1-sulfonic acid dihydrate | ||
|---|---|---|---|---|
| CAS Number | 1171630-97-9 | Molecular Weight | 278.70900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H11ClO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 8-chloronaphthalene-1-sulfonic acid,dihydrate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H11ClO5S |
|---|---|
| Molecular Weight | 278.70900 |
| Exact Mass | 278.00200 |
| PSA | 81.21000 |
| LogP | 3.69210 |
| InChIKey | PILNBXJFSKOZSD-UHFFFAOYSA-N |
| SMILES | O.O.O=S(=O)(O)c1cccc2cccc(Cl)c12 |
| HS Code | 2915900090 |
|---|
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| 8-chloronaphthalenesulfonic acid,oxamethane,oxamethane |
| 8-Chloronaphthalene-1-sulfonic acid dihydrate |