1H-Pyrazole-4-carboxylic acid, 1-(2-chlorophenyl)-5-phenyl
Modify Date: 2026-08-20 23:19:15
1H-Pyrazole-4-carboxylic acid, 1-(2-chlorophenyl)-5-phenyl structure
|
Common Name | 1H-Pyrazole-4-carboxylic acid, 1-(2-chlorophenyl)-5-phenyl | ||
|---|---|---|---|---|
| CAS Number | 1171970-88-9 | Molecular Weight | 298.72 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H11ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1H-Pyrazole-4-carboxylic acid, 1-(2-chlorophenyl)-5-phenyl |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H11ClN2O2 |
|---|---|
| Molecular Weight | 298.72 |
| InChIKey | UOXJMEIQENQNRN-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cnn(-c2ccccc2Cl)c1-c1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 1H-Pyrazole-4-carboxylic acid, 1-(2-chlorophenyl)-5-phenyl? |
| A: InChIKey of 1H-Pyrazole-4-carboxylic acid, 1-(2-chlorophenyl)-5-phenyl is UOXJMEIQENQNRN-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 1H-Pyrazole-4-carboxylic acid, 1-(2-chlorophenyl)-5-phenyl? |
| A: Molecular formula of 1H-Pyrazole-4-carboxylic acid, 1-(2-chlorophenyl)-5-phenyl is C16H11ClN2O2. |
| Q: What is the CAS number of 1H-Pyrazole-4-carboxylic acid, 1-(2-chlorophenyl)-5-phenyl? |
| A: CAS number of 1H-Pyrazole-4-carboxylic acid, 1-(2-chlorophenyl)-5-phenyl is 1171970-88-9. |
| Q: What is the Chinese name of 1171970-88-9? |
| A: Chinese name of 1171970-88-9 is 1171970-88-9. |
| Q: What is the molecular weight of 1H-Pyrazole-4-carboxylic acid, 1-(2-chlorophenyl)-5-phenyl? |
| A: Molecular weight of 1H-Pyrazole-4-carboxylic acid, 1-(2-chlorophenyl)-5-phenyl is 298.72. |
| Q: What is the SMILES notation of 1H-Pyrazole-4-carboxylic acid, 1-(2-chlorophenyl)-5-phenyl? |
| A: SMILES notation of 1H-Pyrazole-4-carboxylic acid, 1-(2-chlorophenyl)-5-phenyl is O=C(O)c1cnn(-c2ccccc2Cl)c1-c1ccccc1. |
| Q: What is the English name of 1H-Pyrazole-4-carboxylic acid, 1-(2-chlorophenyl)-5-phenyl? |
| A: The English name of 1H-Pyrazole-4-carboxylic acid, 1-(2-chlorophenyl)-5-phenyl is 1H-Pyrazole-4-carboxylic acid, 1-(2-chlorophenyl)-5-phenyl. |