AVN-211 structure
|
Common Name | AVN-211 | ||
|---|---|---|---|---|
| CAS Number | 1173103-84-8 | Molecular Weight | 333.428 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C15H15N3O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of AVN-211A novel and highly selective 5-HT6 receptor small molecule antagonist with Ki of 2.34 nM. |
| Name | AVN-211 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Molecular Formula | C15H15N3O2S2 |
| Molecular Weight | 333.428 |
| Exact Mass | 333.060577 |
| LogP | 1.93 |
| Index of Refraction | 1.680 |
| InChIKey | KSAUCBGUWGWPDL-UHFFFAOYSA-N |
| SMILES | CSc1nn2c(C)cc(C)nc2c1S(=O)(=O)c1ccccc1 |
| Pyrazolo[1,5-a]pyrimidine, 5,7-dimethyl-2-(methylthio)-3-(phenylsulfonyl)- |
| AVN-211 |
| 5,7-Dimethyl-2-(methylsulfanyl)-3-(phenylsulfonyl)pyrazolo[1,5-a]pyrimidine |