compound 76-805 structure
|
Common Name | compound 76-805 | ||
|---|---|---|---|---|
| CAS Number | 117345-88-7 | Molecular Weight | 625.32700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H29I2N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | trimethyl-[6-phenyl-3-(trimethylazaniumyl)phenanthridin-8-yl]azanium,diiodide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C25H29I2N3 |
|---|---|
| Molecular Weight | 625.32700 |
| Exact Mass | 625.04500 |
| PSA | 12.89000 |
| InChIKey | UOKNTNXWHGZPQS-UHFFFAOYSA-L |
| SMILES | C[N+](C)(C)c1ccc2c(c1)nc(-c1ccccc1)c1cc([N+](C)(C)C)ccc12.[I-].[I-] |
|
~%
compound 76-805 CAS#:117345-88-7 |
| Literature: Walls; Whittaker Journal of the Chemical Society, <1950> 41, 47 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3,8-Phenanthridinediaminium,N,N,N,N',N',N'-hexamethyl-6-phenyl-,diiodide |
| N,N,N,N',N',N'-Hexamethyl-6-phenyl-3,8-phenanthridinediaminium diiodide |
| Compound 76-805 |