N-(Dichlorophenylsilyl)-1,1,1-trimethylsilanamine
Modify Date: 2025-09-12 16:58:41
N-(Dichlorophenylsilyl)-1,1,1-trimethylsilanamine structure
|
Common Name | N-(Dichlorophenylsilyl)-1,1,1-trimethylsilanamine | ||
|---|---|---|---|---|
| CAS Number | 117367-38-1 | Molecular Weight | 264.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H15Cl2NSi2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(Dichlorophenylsilyl)-1,1,1-trimethylsilanamine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H15Cl2NSi2 |
|---|---|
| Molecular Weight | 264.29 |
| InChIKey | WVXAGHXARWDSLH-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)N[Si](Cl)(Cl)c1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of N-(Dichlorophenylsilyl)-1,1,1-trimethylsilanamine? |
| A: The English name of N-(Dichlorophenylsilyl)-1,1,1-trimethylsilanamine is N-(Dichlorophenylsilyl)-1,1,1-trimethylsilanamine. |
| Q: What is the molecular weight of N-(Dichlorophenylsilyl)-1,1,1-trimethylsilanamine? |
| A: Molecular weight of N-(Dichlorophenylsilyl)-1,1,1-trimethylsilanamine is 264.29. |
| Q: What is the CAS number of N-(Dichlorophenylsilyl)-1,1,1-trimethylsilanamine? |
| A: CAS number of N-(Dichlorophenylsilyl)-1,1,1-trimethylsilanamine is 117367-38-1. |
| Q: What is the InChIKey of N-(Dichlorophenylsilyl)-1,1,1-trimethylsilanamine? |
| A: InChIKey of N-(Dichlorophenylsilyl)-1,1,1-trimethylsilanamine is WVXAGHXARWDSLH-UHFFFAOYSA-N. |
| Q: What is the molecular formula of N-(Dichlorophenylsilyl)-1,1,1-trimethylsilanamine? |
| A: Molecular formula of N-(Dichlorophenylsilyl)-1,1,1-trimethylsilanamine is C9H15Cl2NSi2. |
| Q: What is the Chinese name of 117367-38-1? |
| A: Chinese name of 117367-38-1 is 117367-38-1. |
| Q: What is the SMILES notation of N-(Dichlorophenylsilyl)-1,1,1-trimethylsilanamine? |
| A: SMILES notation of N-(Dichlorophenylsilyl)-1,1,1-trimethylsilanamine is C[Si](C)(C)N[Si](Cl)(Cl)c1ccccc1. |