N-[(4-hydroxyphenyl)carbamothioyl]-5-nitrofuran-3-carboxamide
Modify Date: 2024-11-18 15:18:21
![N-[(4-hydroxyphenyl)carbamothioyl]-5-nitrofuran-3-carboxamide Structure](https://image.chemsrc.com/caspic/067/117457-83-7.png)
N-[(4-hydroxyphenyl)carbamothioyl]-5-nitrofuran-3-carboxamide structure
|
Common Name | N-[(4-hydroxyphenyl)carbamothioyl]-5-nitrofuran-3-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 117457-83-7 | Molecular Weight | 307.28200 | |
| Density | 1.603g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H9N3O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[(4-hydroxyphenyl)carbamothioyl]-5-nitrofuran-3-carboxamide |
|---|
| Density | 1.603g/cm3 |
|---|---|
| Molecular Formula | C12H9N3O5S |
| Molecular Weight | 307.28200 |
| Exact Mass | 307.02600 |
| PSA | 155.90000 |
| LogP | 3.19120 |
| Index of Refraction | 1.737 |
| InChIKey | CQCPQMQDNUKNDJ-UHFFFAOYSA-N |
| SMILES | O=C(NC(=S)Nc1ccc(O)cc1)c1coc([N+](=O)[O-])c1 |
|
~10%
N-[(4-hydroxyph... CAS#:117457-83-7 |
| Literature: Jurasek, Adolf; Stetinova, Jarmila; Kovac, Jaroslav; Zvak, Vladimir; Lesko, Jan; et al Collection of Czechoslovak Chemical Communications, 1989 , vol. 54, # 3 p. 699 - 705 |
|
~%
N-[(4-hydroxyph... CAS#:117457-83-7 |
| Literature: Collection of Czechoslovak Chemical Communications, , vol. 54, # 3 p. 699 - 705 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |