N-((4-methyl-5-methylene-2-oxo-1,3-dioxolan-4-yl)oxy)norfloxacin structure
|
Common Name | N-((4-methyl-5-methylene-2-oxo-1,3-dioxolan-4-yl)oxy)norfloxacin | ||
|---|---|---|---|---|
| CAS Number | 117458-86-3 | Molecular Weight | 447.41400 | |
| Density | 1.5g/cm3 | Boiling Point | 620ºC at 760mmHg | |
| Molecular Formula | C21H22FN3O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 328.8ºC | |
| Name | 1-ethyl-6-fluoro-7-[4-[(4-methyl-5-methylidene-2-oxo-1,3-dioxolan-4-yl)oxy]piperazin-1-yl]-4-oxoquinoline-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5g/cm3 |
|---|---|
| Boiling Point | 620ºC at 760mmHg |
| Molecular Formula | C21H22FN3O7 |
| Molecular Weight | 447.41400 |
| Flash Point | 328.8ºC |
| Exact Mass | 447.14400 |
| PSA | 110.54000 |
| LogP | 2.31190 |
| Vapour Pressure | 3.13E-16mmHg at 25°C |
| Index of Refraction | 1.649 |
| InChIKey | ZBDVTPRXALZLIJ-UHFFFAOYSA-N |
| SMILES | C=C1OC(=O)OC1(C)ON1CCN(c2cc3c(cc2F)c(=O)c(C(=O)O)cn3CC)CC1 |
|
~70%
N-((4-methyl-5-... CAS#:117458-86-3 |
| Literature: Kondo, Hirosato; Sakamoto, Fumio; Uno, Toshio; Kawahata, Yoshihiro; Tsukamoto, Goro Journal of Medicinal Chemistry, 1989 , vol. 32, # 3 p. 671 - 674 |
|
~95%
N-((4-methyl-5-... CAS#:117458-86-3 |
| Literature: Kondo, Hirosato; Sakamoto, Fumio; Uno, Toshio; Kawahata, Yoshihiro; Tsukamoto, Goro Journal of Medicinal Chemistry, 1989 , vol. 32, # 3 p. 671 - 674 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-acetylamino-4-methyl-thiazole |
| 2-acetamido-4-methylthiazole |
| 4-methyl-2-acetamidothiazole |