2,6-bis(trimethylsilyl)benzenethiol structure
|
Common Name | 2,6-bis(trimethylsilyl)benzenethiol | ||
|---|---|---|---|---|
| CAS Number | 117526-63-3 | Molecular Weight | 254.53900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H22SSi2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,6-bis(trimethylsilyl)benzenethiol |
|---|
| Molecular Formula | C12H22SSi2 |
|---|---|
| Molecular Weight | 254.53900 |
| Exact Mass | 254.09800 |
| PSA | 38.80000 |
| LogP | 3.06570 |
| InChIKey | LTBASNVRAKBBJU-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)c1cccc([Si](C)(C)C)c1S |
|
~%
2,6-bis(trimeth... CAS#:117526-63-3 |
| Literature: Block,E.; Eswarakrishnan,V.; Gernon,M. Journal of the American Chemical Society, 1989 , vol. 111, p. 658 |
|
~%
2,6-bis(trimeth... CAS#:117526-63-3 |
| Literature: Block,E.; Eswarakrishnan,V.; Gernon,M. Journal of the American Chemical Society, 1989 , vol. 111, p. 658 |
|
~%
2,6-bis(trimeth... CAS#:117526-63-3 |
| Literature: Block,E.; Eswarakrishnan,V.; Gernon,M. Journal of the American Chemical Society, 1989 , vol. 111, p. 658 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |