5-methylxanthen-9-one-4-acetic acid structure
|
Common Name | 5-methylxanthen-9-one-4-acetic acid | ||
|---|---|---|---|---|
| CAS Number | 117570-47-5 | Molecular Weight | 268.26400 | |
| Density | 1.359g/cm3 | Boiling Point | 511.9ºC at 760mmHg | |
| Molecular Formula | C16H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.1ºC | |
| Name | 2-(5-methyl-9-oxoxanthen-4-yl)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.359g/cm3 |
|---|---|
| Boiling Point | 511.9ºC at 760mmHg |
| Molecular Formula | C16H12O4 |
| Molecular Weight | 268.26400 |
| Flash Point | 197.1ºC |
| Exact Mass | 268.07400 |
| PSA | 67.51000 |
| LogP | 2.88170 |
| Vapour Pressure | 2.64E-11mmHg at 25°C |
| Index of Refraction | 1.644 |
| InChIKey | SOPCFHVRSZJNSW-UHFFFAOYSA-N |
| SMILES | Cc1cccc2c(=O)c3cccc(CC(=O)O)c3oc12 |
|
~%
5-methylxanthen... CAS#:117570-47-5 |
| Literature: Rewcastle, Gordon W.; Atwell, Graham J.; Baguley, Bruce C.; Calveley, Stephen B.; Denny, William A. Journal of Medicinal Chemistry, 1989 , vol. 32, # 4 p. 793 - 799 |
|
~%
5-methylxanthen... CAS#:117570-47-5 |
| Literature: Rewcastle, Gordon W.; Atwell, Graham J.; Baguley, Bruce C.; Calveley, Stephen B.; Denny, William A. Journal of Medicinal Chemistry, 1989 , vol. 32, # 4 p. 793 - 799 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 5-Methylxanthanone acetic acid |
| 5-Mexaa |
| 9H-Xanthene-4-aceticacid,5-methyl-9-oxo |
| 5-methylxanthenone-4-acetic acid |