1-Benzyl-2,2-dimethyl-4-piperidinone structure
|
Common Name | 1-Benzyl-2,2-dimethyl-4-piperidinone | ||
|---|---|---|---|---|
| CAS Number | 117623-46-8 | Molecular Weight | 217.307 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 318.0±22.0 °C at 760 mmHg | |
| Molecular Formula | C14H19NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 136.7±11.9 °C | |
| Name | 1-benzyl-2,2-dimethylpiperidin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 318.0±22.0 °C at 760 mmHg |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.307 |
| Flash Point | 136.7±11.9 °C |
| Exact Mass | 217.146667 |
| PSA | 20.31000 |
| LogP | 2.22 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.531 |
| InChIKey | QXCCSKIRCJMSMM-UHFFFAOYSA-N |
| SMILES | CC1(C)CC(=O)CCN1Cc1ccccc1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-Benzyl-2,2-dimethyl-4-piperidinone |
| 4-Piperidinone, 2,2-dimethyl-1-(phenylmethyl)- |