3'-azido-3'-deoxy-5'-O-beta-glucopyranuronosylthymidine structure
|
Common Name | 3'-azido-3'-deoxy-5'-O-beta-glucopyranuronosylthymidine | ||
|---|---|---|---|---|
| CAS Number | 117675-21-5 | Molecular Weight | 443.37 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H21N5O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 3'-azido-3'-deoxy-5'-O-beta-glucopyranuronosylthymidineZidovudine O-β-D-glucuronide (3'-Azido-3'-deoxythymidine β-D-glucuronide) sodium is the major metabolite of Zidovudine. Zidovudine is a nucleoside reverse transcriptase inhibitor (NRTI), widely used to treat HIV infection[1][2]. |
| Name | (2S,3S,4S,5R)-6-[[(2S)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Zidovudine O-β-D-glucuronide (3'-Azido-3'-deoxythymidine β-D-glucuronide) sodium is the major metabolite of Zidovudine. Zidovudine is a nucleoside reverse transcriptase inhibitor (NRTI), widely used to treat HIV infection[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C16H21N5O10 |
|---|---|
| Molecular Weight | 443.37 |
| Exact Mass | 443.12900 |
| PSA | 230.55000 |
| InChIKey | NFXAJWJJNLWLOV-OTQDERTISA-N |
| SMILES | Cc1cn(C2CC(N=[N+]=[N-])C(COC3OC(C(=O)O)C(O)C(O)C3O)O2)c(=O)[nH]c1=O |
| Zidovudine glucuronide |
| UNII-CD09F5JM6T |
| GAZT |
| AZT glucuronide |