5-(2,3-Dihydro-1,4-benzodioxin-6-yl)-1-methylpyrazole-3-carbaldehyde structure
|
Common Name | 5-(2,3-Dihydro-1,4-benzodioxin-6-yl)-1-methylpyrazole-3-carbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 1177348-75-2 | Molecular Weight | 244.25 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H12N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-(2,3-Dihydro-1,4-benzodioxin-6-yl)-1-methylpyrazole-3-carbaldehyde |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H12N2O3 |
|---|---|
| Molecular Weight | 244.25 |
| InChIKey | YINQREWSJKBAQU-UHFFFAOYSA-N |
| SMILES | Cn1nc(C=O)cc1-c1ccc2c(c1)OCCO2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 5-(2,3-Dihydro-1,4-benzodioxin-6-yl)-1-methylpyrazole-3-carbaldehyde? |
| A: The English name of 5-(2,3-Dihydro-1,4-benzodioxin-6-yl)-1-methylpyrazole-3-carbaldehyde is 5-(2,3-Dihydro-1,4-benzodioxin-6-yl)-1-methylpyrazole-3-carbaldehyde. |
| Q: What is the InChIKey of 5-(2,3-Dihydro-1,4-benzodioxin-6-yl)-1-methylpyrazole-3-carbaldehyde? |
| A: InChIKey of 5-(2,3-Dihydro-1,4-benzodioxin-6-yl)-1-methylpyrazole-3-carbaldehyde is YINQREWSJKBAQU-UHFFFAOYSA-N. |
| Q: What is the CAS number of 5-(2,3-Dihydro-1,4-benzodioxin-6-yl)-1-methylpyrazole-3-carbaldehyde? |
| A: CAS number of 5-(2,3-Dihydro-1,4-benzodioxin-6-yl)-1-methylpyrazole-3-carbaldehyde is 1177348-75-2. |
| Q: What is the SMILES notation of 5-(2,3-Dihydro-1,4-benzodioxin-6-yl)-1-methylpyrazole-3-carbaldehyde? |
| A: SMILES notation of 5-(2,3-Dihydro-1,4-benzodioxin-6-yl)-1-methylpyrazole-3-carbaldehyde is Cn1nc(C=O)cc1-c1ccc2c(c1)OCCO2. |
| Q: What is the molecular weight of 5-(2,3-Dihydro-1,4-benzodioxin-6-yl)-1-methylpyrazole-3-carbaldehyde? |
| A: Molecular weight of 5-(2,3-Dihydro-1,4-benzodioxin-6-yl)-1-methylpyrazole-3-carbaldehyde is 244.25. |
| Q: What is the Chinese name of 1177348-75-2? |
| A: Chinese name of 1177348-75-2 is 1177348-75-2. |
| Q: What is the molecular formula of 5-(2,3-Dihydro-1,4-benzodioxin-6-yl)-1-methylpyrazole-3-carbaldehyde? |
| A: Molecular formula of 5-(2,3-Dihydro-1,4-benzodioxin-6-yl)-1-methylpyrazole-3-carbaldehyde is C13H12N2O3. |