3,5-Dichloro-4-iodobenzoic acid structure
|
Common Name | 3,5-Dichloro-4-iodobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 117757-68-3 | Molecular Weight | 316.90800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H3Cl2IO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,5-Dichloro-4-iodobenzoic acid |
|---|
| Molecular Formula | C7H3Cl2IO2 |
|---|---|
| Molecular Weight | 316.90800 |
| Exact Mass | 315.85500 |
| PSA | 37.30000 |
| LogP | 3.29620 |
| InChIKey | QNSGDQZRDPAUTG-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(Cl)c(I)c(Cl)c1 |
| HS Code | 2916399090 |
|---|
|
~%
3,5-Dichloro-4-... CAS#:117757-68-3 |
| Literature: EP279698 A3, ; |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Name: qHTS assay for inhibitors of human lactate dehydrogenase
Source: NCGC
Target: N/A
External Id: LDHA
|
|
Name: Primary qHTS Assay for Foot and Mouth Disease Virus Antivirals against NCGC Sytravon ...
Source: NCGC
External Id: stopgo-p2-SytraCBC-dual-FF
|
|
Name: Primary qHTS Assay for Foot and Mouth Disease Virus Antivirals against NCGC Sytravon ...
Source: NCGC
External Id: stopgo-p2-SytraCBC-dual-Ren
|