A-BROMO-N-BOC-GLY-OTBU structure
|
Common Name | A-BROMO-N-BOC-GLY-OTBU | ||
|---|---|---|---|---|
| CAS Number | 117833-60-0 | Molecular Weight | 310.185 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 337.8±32.0 °C at 760 mmHg | |
| Molecular Formula | C11H20BrNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158.1±25.1 °C | |
| Name | tert-butyl 2-bromo-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 337.8±32.0 °C at 760 mmHg |
| Molecular Formula | C11H20BrNO4 |
| Molecular Weight | 310.185 |
| Flash Point | 158.1±25.1 °C |
| Exact Mass | 309.057556 |
| PSA | 68.12000 |
| LogP | 3.76 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.478 |
| InChIKey | RBGAAZPKHKBDGM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(Br)C(=O)OC(C)(C)C |
| HS Code | 2924199090 |
|---|
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Methyl-2-propanyl bromo({[(2-methyl-2-propanyl)oxy]carbonyl}amino)acetate |
| Acetic acid, 2-bromo-2-[[(1,1-dimethylethoxy)carbonyl]amino]-, 1,1-dimethylethyl ester |
| Alfa-Bromo-N-Boc-Gly-OtBu |
| tert-butyl N-Boc-bromoglycinate |