2-(tert-Butylsulfonyl)-1-phenylpropan-1-one structure
|
Common Name | 2-(tert-Butylsulfonyl)-1-phenylpropan-1-one | ||
|---|---|---|---|---|
| CAS Number | 117841-16-4 | Molecular Weight | 254.35 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 419.5±28.0 °C at 760 mmHg | |
| Molecular Formula | C13H18O3S | Melting Point | 121-124℃ | |
| MSDS | N/A | Flash Point | 250.0±16.7 °C | |
Use of 2-(tert-Butylsulfonyl)-1-phenylpropan-1-oneDescription 2-(tert-Butylsulfonyl)-1-phenylpropan-1-one is part of a suite of reagents developed by the Li group for late-stage functionalization of pharmaceutically relevant compounds. The reagents serve as precursors to alkyl radicals generated under light mediated, redox-neutral and catalyst free conditions for use in the Minisci alkylation of aromatics. |
| Name | 2-(tert-Butylsulfonyl)-1-phenylpropan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 419.5±28.0 °C at 760 mmHg |
| Melting Point | 121-124℃ |
| Molecular Formula | C13H18O3S |
| Molecular Weight | 254.35 |
| Flash Point | 250.0±16.7 °C |
| Exact Mass | 254.097672 |
| LogP | 1.84 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.517 |
| InChIKey | TVSDOFIMIDCPNJ-UHFFFAOYSA-N |
| SMILES | CC(C(=O)c1ccccc1)S(=O)(=O)C(C)(C)C |
| 2-[(2-Methyl-2-propanyl)sulfonyl]-1-phenyl-1-propanone |
| 1-Propanone, 2-[(1,1-dimethylethyl)sulfonyl]-1-phenyl- |