4-(2,4-dimethoxyphenyl)-5-methyl-1,3-thiazol-2-amine structure
|
Common Name | 4-(2,4-dimethoxyphenyl)-5-methyl-1,3-thiazol-2-amine | ||
|---|---|---|---|---|
| CAS Number | 117844-98-1 | Molecular Weight | 250.31700 | |
| Density | 1.227g/cm3 | Boiling Point | 387.6ºC at 760 mmHg | |
| Molecular Formula | C12H14N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188.2ºC | |
| Name | 4-(2,4-dimethoxyphenyl)-5-methyl-1,3-thiazol-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.227g/cm3 |
|---|---|
| Boiling Point | 387.6ºC at 760 mmHg |
| Molecular Formula | C12H14N2O2S |
| Molecular Weight | 250.31700 |
| Flash Point | 188.2ºC |
| Exact Mass | 250.07800 |
| PSA | 85.61000 |
| LogP | 3.29910 |
| Vapour Pressure | 3.26E-06mmHg at 25°C |
| Index of Refraction | 1.599 |
| InChIKey | DBRUGROLIZNWFM-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2nc(N)sc2C)c(OC)c1 |
| HS Code | 2934100090 |
|---|
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 2-Thiazolamine,4-(2,4-dimethoxyphenyl)-5-methyl |