benzoyl(methoxy)phosphinate structure
|
Common Name | benzoyl(methoxy)phosphinate | ||
|---|---|---|---|---|
| CAS Number | 117927-83-0 | Molecular Weight | 199.12000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H8O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | benzoyl(methoxy)phosphinate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H8O4P |
|---|---|
| Molecular Weight | 199.12000 |
| Exact Mass | 199.01600 |
| PSA | 76.24000 |
| LogP | 2.09680 |
| InChIKey | ZOCJMJWPRNIOOS-UHFFFAOYSA-M |
| SMILES | COP(=O)([O-])C(=O)c1ccccc1 |
|
~92%
benzoyl(methoxy... CAS#:117927-83-0 |
| Literature: Karaman, Rafik; Goldblum, Amiram; Breuer, Eli; Leader, Haim Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1989 , p. 765 - 774 |
|
~%
benzoyl(methoxy... CAS#:117927-83-0 |
| Literature: Karaman, Rafik; Goldblum, Amiram; Breuer, Eli; Leader, Haim Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1989 , p. 765 - 774 |
|
~%
benzoyl(methoxy... CAS#:117927-83-0 |
| Literature: Karaman, Rafik; Goldblum, Amiram; Breuer, Eli; Leader, Haim Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1989 , p. 765 - 774 |
| methyl hydrogen benzoylphosphonate |
| Phosphonic acid,benzoyl-,monomethyl ester |