2-(2-bromo-4-tert-butylphenoxy)acetic acid structure
|
Common Name | 2-(2-bromo-4-tert-butylphenoxy)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 117947-05-4 | Molecular Weight | 287.15000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H15BrO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(2-bromo-4-tert-butylphenoxy)acetic acid |
|---|
| Molecular Formula | C12H15BrO3 |
|---|---|
| Molecular Weight | 287.15000 |
| Exact Mass | 286.02000 |
| PSA | 46.53000 |
| LogP | 3.21000 |
| InChIKey | PJNXDLJWFAAMPA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(OCC(=O)O)c(Br)c1 |
| HS Code | 2918990090 |
|---|
|
~89%
2-(2-bromo-4-te... CAS#:117947-05-4 |
| Literature: AMOREPACIFIC CORPORATION Patent: WO2007/120012 A1, 2007 ; Location in patent: Page/Page column 105 ; WO 2007/120012 A1 |
|
~%
2-(2-bromo-4-te... CAS#:117947-05-4 |
| Literature: Newman; Fones; Renoll Journal of the American Chemical Society, 1947 , vol. 69, p. 718,721 |
|
~%
2-(2-bromo-4-te... CAS#:117947-05-4 |
| Literature: Takahashi, Eiki; Hirano, Noriyuki; Nagahara, Takashi; Yoshikawa, Satoru; Momen, Shinobu; Yokokawa, Hiroshi; Hayashi, Ryoji Bioorganic and Medicinal Chemistry Letters, 2013 , vol. 23, # 11 p. 3154 - 3156 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |