2-hydroxyphenanthrene-3-carboxylic acid structure
|
Common Name | 2-hydroxyphenanthrene-3-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 117978-17-3 | Molecular Weight | 238.23800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H10O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-hydroxyphenanthrene-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H10O3 |
|---|---|
| Molecular Weight | 238.23800 |
| Exact Mass | 238.06300 |
| PSA | 57.53000 |
| LogP | 3.39680 |
| InChIKey | HRMHOILNYDWFNX-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc2c(ccc3ccccc32)cc1O |
|
~%
2-hydroxyphenan... CAS#:117978-17-3 |
| Literature: Gilman; Cook Journal of the American Chemical Society, 1940 , vol. 62, p. 2813,2815 |
|
~%
Detail
|
| Literature: Gilman; Cook Journal of the American Chemical Society, 1940 , vol. 62, p. 2813,2815 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| 3-Phenanthrenecarboxylicacid,2-hydroxy |
| 2-Hydroxy-phenanthren-3-carbonsaeure |
| 2-hydroxy-phenanthrene-3-carboxylic acid |