Benzoic acid,2-[[[2-(ethoxycarbonyl)phenoxy]carbonyl]oxy]-, ethyl ester structure
|
Common Name | Benzoic acid,2-[[[2-(ethoxycarbonyl)phenoxy]carbonyl]oxy]-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 118-27-4 | Molecular Weight | 358.34200 | |
| Density | 1.245g/cm3 | Boiling Point | 479.9ºC at 760mmHg | |
| Molecular Formula | C19H18O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.3ºC | |
| Name | ethyl 2-(2-ethoxycarbonylphenoxy)carbonyloxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.245g/cm3 |
|---|---|
| Boiling Point | 479.9ºC at 760mmHg |
| Molecular Formula | C19H18O7 |
| Molecular Weight | 358.34200 |
| Flash Point | 210.3ºC |
| Exact Mass | 358.10500 |
| PSA | 88.13000 |
| LogP | 3.61780 |
| Vapour Pressure | 2.28E-09mmHg at 25°C |
| Index of Refraction | 1.552 |
| InChIKey | QWWLHNFYJSCNGD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccccc1OC(=O)Oc1ccccc1C(=O)OCC |
| HS Code | 2918990090 |
|---|
|
~%
Benzoic acid,2-... CAS#:118-27-4 |
| Literature: Dow Chem. Co. Patent: US1877304 , 1929 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| diethyl 2,2'-[carbonylbis(oxy)]dibenzoate |
| Diethyl 2,2'-(carbonylbis(oxy))bisbenzoate |
| Ethyl salicylate carbonate |
| carbonic acid bis-(2-ethoxycarbonyl-phenyl ester) |
| EINECS 204-239-3 |
| Kohlensaeure-bis-(2-aethoxycarbonyl-phenylester) |
| Carbonic acid,diester with ethyl salicylate |
| Carbethyl salicylate |
| Sal Ethyl carbonate |