Benzenesulfonic acid,2,5-dichloro-4-hydrazinyl structure
|
Common Name | Benzenesulfonic acid,2,5-dichloro-4-hydrazinyl | ||
|---|---|---|---|---|
| CAS Number | 118-89-8 | Molecular Weight | 257.09400 | |
| Density | 1.801g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C6H6Cl2N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,5-dichloro-4-hydrazinylbenzenesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.801g/cm3 |
|---|---|
| Molecular Formula | C6H6Cl2N2O3S |
| Molecular Weight | 257.09400 |
| Exact Mass | 255.94800 |
| PSA | 100.80000 |
| LogP | 3.37980 |
| Index of Refraction | 1.681 |
| InChIKey | TVSCIUWLNZAPPU-UHFFFAOYSA-N |
| SMILES | NNc1cc(Cl)c(S(=O)(=O)O)cc1Cl |
| HS Code | 2928000090 |
|---|
|
~%
Benzenesulfonic... CAS#:118-89-8 |
| Literature: Noelting; Kopp Chemische Berichte, 1905 , vol. 38, p. 3515 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| EINECS 204-283-3 |
| 2,5-dichloro-4-sulphophenylhydrazine |
| 2,4-DIFLUORO-3'-PYRROLIDINOMETHYL BENZOPHENONE |
| 2.5-Dichlor-phenylhydrazin-sulfonsaeure-(4) |
| 2,5-Dichloro-4-hydrazinobenzenesulfonic acid |
| 2,5-Dichlor-4-hydrazino-benzolsulfonsaeure |