2-(2'-(Trifluoromethyl)biphenyl-3-yl)-ethylamine
Modify Date: 2025-11-06 18:27:26
2-(2'-(Trifluoromethyl)biphenyl-3-yl)-ethylamine structure
|
Common Name | 2-(2'-(Trifluoromethyl)biphenyl-3-yl)-ethylamine | ||
|---|---|---|---|---|
| CAS Number | 1181237-79-5 | Molecular Weight | 265.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H14F3N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(2'-(Trifluoromethyl)biphenyl-3-yl)-ethylamine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H14F3N |
|---|---|
| Molecular Weight | 265.27 |
| InChIKey | MDHWRFZISHSULO-UHFFFAOYSA-N |
| SMILES | NCCc1cccc(-c2ccccc2C(F)(F)F)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2-(2'-(Trifluoromethyl)biphenyl-3-yl)-ethylamine? |
| A: CAS number of 2-(2'-(Trifluoromethyl)biphenyl-3-yl)-ethylamine is 1181237-79-5. |
| Q: What is the SMILES notation of 2-(2'-(Trifluoromethyl)biphenyl-3-yl)-ethylamine? |
| A: SMILES notation of 2-(2'-(Trifluoromethyl)biphenyl-3-yl)-ethylamine is NCCc1cccc(-c2ccccc2C(F)(F)F)c1. |
| Q: What is the Chinese name of 1181237-79-5? |
| A: Chinese name of 1181237-79-5 is 1181237-79-5. |
| Q: What is the InChIKey of 2-(2'-(Trifluoromethyl)biphenyl-3-yl)-ethylamine? |
| A: InChIKey of 2-(2'-(Trifluoromethyl)biphenyl-3-yl)-ethylamine is MDHWRFZISHSULO-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 2-(2'-(Trifluoromethyl)biphenyl-3-yl)-ethylamine? |
| A: Molecular weight of 2-(2'-(Trifluoromethyl)biphenyl-3-yl)-ethylamine is 265.27. |
| Q: What is the English name of 2-(2'-(Trifluoromethyl)biphenyl-3-yl)-ethylamine? |
| A: The English name of 2-(2'-(Trifluoromethyl)biphenyl-3-yl)-ethylamine is 2-(2'-(Trifluoromethyl)biphenyl-3-yl)-ethylamine. |
| Q: What is the molecular formula of 2-(2'-(Trifluoromethyl)biphenyl-3-yl)-ethylamine? |
| A: Molecular formula of 2-(2'-(Trifluoromethyl)biphenyl-3-yl)-ethylamine is C15H14F3N. |