23-Nor-6-oxopristimerol
Modify Date: 2025-08-20 19:00:14
23-Nor-6-oxopristimerol structure
|
Common Name | 23-Nor-6-oxopristimerol | ||
|---|---|---|---|---|
| CAS Number | 118172-79-5 | Molecular Weight | 466.609 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 605.6±55.0 °C at 760 mmHg | |
| Molecular Formula | C29H38O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 195.9±25.0 °C | |
Use of 23-Nor-6-oxopristimerol23-Nor-6-oxopristimerol is a phenolic dinor-triterpene[1]. |
| Name | Methyl (2R,4aS,6aS,12bR,14aS,14bR)-10,11-dihydroxy-2,4a,6a,12b,14a-pentamethyl-8-oxo-1,2,3,4,4a,5,6,6a,8,12b,13,14,14a,14b-tetradecahydro-2-picenecarboxylate |
|---|---|
| Synonym | More Synonyms |
| Description | 23-Nor-6-oxopristimerol is a phenolic dinor-triterpene[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 605.6±55.0 °C at 760 mmHg |
| Molecular Formula | C29H38O5 |
| Molecular Weight | 466.609 |
| Flash Point | 195.9±25.0 °C |
| Exact Mass | 466.271912 |
| LogP | 6.89 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.602 |
| InChIKey | GCBFITRLUGEXIX-UHKCKZGUSA-N |
| SMILES | COC(=O)C1(C)CCC2(C)CCC3(C)C4=CC(=O)c5cc(O)c(O)cc5C4(C)CCC3(C)C2C1 |
| 2-Picenecarboxylic acid, 1,2,3,4,4a,5,6,6a,8,12b,13,14,14a,14b-tetradecahydro-10,11-dihydroxy-2,4a,6a,12b,14a-pentamethyl-8-oxo-, methyl ester, (2R,4aS,6aS,12bR,14aS,14bR)- |
| Methyl (2R,4aS,6aS,12bR,14aS,14bR)-10,11-dihydroxy-2,4a,6a,12b,14a-pentamethyl-8-oxo-1,2,3,4,4a,5,6,6a,8,12b,13,14,14a,14b-tetradecahydro-2-picenecarboxylate |