4-tert-butyl-(3-(2-chloroethyl)ureido)benzene structure
|
Common Name | 4-tert-butyl-(3-(2-chloroethyl)ureido)benzene | ||
|---|---|---|---|---|
| CAS Number | 118202-59-8 | Molecular Weight | 254.75600 | |
| Density | 1.127g/cm3 | Boiling Point | 342.8ºC at 760mmHg | |
| Molecular Formula | C13H19ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 161.1ºC | |
| Name | 1-(4-tert-butylphenyl)-3-(2-chloroethyl)urea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.127g/cm3 |
|---|---|
| Boiling Point | 342.8ºC at 760mmHg |
| Molecular Formula | C13H19ClN2O |
| Molecular Weight | 254.75600 |
| Flash Point | 161.1ºC |
| Exact Mass | 254.11900 |
| PSA | 44.62000 |
| LogP | 3.62180 |
| Vapour Pressure | 7.37E-05mmHg at 25°C |
| Index of Refraction | 1.55 |
| InChIKey | LZYHJNCQMJNPKL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(NC(=O)NCCCl)cc1 |
| HS Code | 2924299090 |
|---|
|
~88%
4-tert-butyl-(3... CAS#:118202-59-8 |
| Literature: IMOTEP INC. Patent: WO2004/106292 A1, 2004 ; Location in patent: Page 57 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| phenylchloroethylurea |
| tBCEU |
| 4-tert-butylCEU |