Z-Phe-Lys-2,4,6-trimethylbenzoyloxy-methylketone trifluoroacetate salt structure
|
Common Name | Z-Phe-Lys-2,4,6-trimethylbenzoyloxy-methylketone trifluoroacetate salt | ||
|---|---|---|---|---|
| CAS Number | 118253-05-7 | Molecular Weight | 587.71 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C34H41N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Z-Phe-Lys-2,4,6-trimethylbenzoyloxy-methylketone trifluoroacetate saltZ-FK-ck (Z-Phe-Lys-2,4,6-Trimethylbenzoyloxy-methylketone) is a potent and selective gingipain-K-specific inhibitor. Z-FK-ck prolongs plasma thrombin time (TT) in a dose- and time-dependent manner[1]. |
| Name | [(3S)-7-amino-2-oxo-3-[[(2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]heptyl] 2,4,6-trimethylbenzoate,2,2,2-trifluoroacetic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Z-FK-ck (Z-Phe-Lys-2,4,6-Trimethylbenzoyloxy-methylketone) is a potent and selective gingipain-K-specific inhibitor. Z-FK-ck prolongs plasma thrombin time (TT) in a dose- and time-dependent manner[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C34H41N3O6 |
|---|---|
| Molecular Weight | 587.71 |
| Exact Mass | 623.27600 |
| PSA | 136.82000 |
| LogP | 6.77330 |
| InChIKey | YSVZQBHVVBVWKO-VMPREFPWSA-N |
| SMILES | Cc1cc(C)c(C(=O)OCC(=O)C(CCCCN)NC(=O)C(Cc2ccccc2)NC(=O)OCc2ccccc2)c(C)c1 |
| (S)-7-Amino-3-((S)-2-(((benzyloxy)carbonyl)amino)-3-phenylpropanamido)-2-oxoheptyl 2,4,6-trimethylbenzoate 2,2,2-trifluoroacetate |