6-benzyl-4-methyl-N-(2-morpholin-4-ylethyl)pyridazin-3-amine,dihydrochloride structure
|
Common Name | 6-benzyl-4-methyl-N-(2-morpholin-4-ylethyl)pyridazin-3-amine,dihydrochloride | ||
|---|---|---|---|---|
| CAS Number | 118270-00-1 | Molecular Weight | 385.33100 | |
| Density | N/A | Boiling Point | 537.4ºC at 760mmHg | |
| Molecular Formula | C18H26Cl2N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 278.8ºC | |
| Name | 6-benzyl-4-methyl-N-(2-morpholin-4-ylethyl)pyridazin-3-amine,dihydrochloride |
|---|
| Boiling Point | 537.4ºC at 760mmHg |
|---|---|
| Molecular Formula | C18H26Cl2N4O |
| Molecular Weight | 385.33100 |
| Flash Point | 278.8ºC |
| Exact Mass | 384.14800 |
| PSA | 53.51000 |
| LogP | 3.08370 |
| Vapour Pressure | 1.27E-11mmHg at 25°C |
| InChIKey | HJLMJCLZOCUCJD-UHFFFAOYSA-N |
| SMILES | Cc1cc(Cc2ccccc2)nnc1NCCN1CCOCC1.Cl.Cl |
|
~%
6-benzyl-4-meth... CAS#:118270-00-1 |
| Literature: Wermuth; Schlewer; Bourguignon; Maghioros; Bouchet; Moire; Kan; Worms; Biziere Journal of Medicinal Chemistry, 1989 , vol. 32, # 3 p. 528 - 537 |
|
~%
6-benzyl-4-meth... CAS#:118270-00-1 |
| Literature: Wermuth; Schlewer; Bourguignon; Maghioros; Bouchet; Moire; Kan; Worms; Biziere Journal of Medicinal Chemistry, 1989 , vol. 32, # 3 p. 528 - 537 |
|
~%
6-benzyl-4-meth... CAS#:118270-00-1 |
| Literature: Wermuth; Schlewer; Bourguignon; Maghioros; Bouchet; Moire; Kan; Worms; Biziere Journal of Medicinal Chemistry, 1989 , vol. 32, # 3 p. 528 - 537 |