2-Propanesulfonamide,n-(2,3-dihydro-1h-indol-5-yl) structure
|
Common Name | 2-Propanesulfonamide,n-(2,3-dihydro-1h-indol-5-yl) | ||
|---|---|---|---|---|
| CAS Number | 1182879-75-9 | Molecular Weight | 240.32 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H16N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Propanesulfonamide,n-(2,3-dihydro-1h-indol-5-yl) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H16N2O2S |
|---|---|
| Molecular Weight | 240.32 |
| InChIKey | AZGLUZZPFYPPJQ-UHFFFAOYSA-N |
| SMILES | CC(C)S(=O)(=O)Nc1ccc2c(c1)CCN2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 2-Propanesulfonamide,n-(2,3-dihydro-1h-indol-5-yl)? |
| A: The English name of 2-Propanesulfonamide,n-(2,3-dihydro-1h-indol-5-yl) is 2-Propanesulfonamide,n-(2,3-dihydro-1h-indol-5-yl). |
| Q: What is the InChIKey of 2-Propanesulfonamide,n-(2,3-dihydro-1h-indol-5-yl)? |
| A: InChIKey of 2-Propanesulfonamide,n-(2,3-dihydro-1h-indol-5-yl) is AZGLUZZPFYPPJQ-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 2-Propanesulfonamide,n-(2,3-dihydro-1h-indol-5-yl)? |
| A: SMILES notation of 2-Propanesulfonamide,n-(2,3-dihydro-1h-indol-5-yl) is CC(C)S(=O)(=O)Nc1ccc2c(c1)CCN2. |
| Q: What is the molecular weight of 2-Propanesulfonamide,n-(2,3-dihydro-1h-indol-5-yl)? |
| A: Molecular weight of 2-Propanesulfonamide,n-(2,3-dihydro-1h-indol-5-yl) is 240.32. |
| Q: What is the Chinese name of 1182879-75-9? |
| A: Chinese name of 1182879-75-9 is 1182879-75-9. |
| Q: What is the molecular formula of 2-Propanesulfonamide,n-(2,3-dihydro-1h-indol-5-yl)? |
| A: Molecular formula of 2-Propanesulfonamide,n-(2,3-dihydro-1h-indol-5-yl) is C11H16N2O2S. |
| Q: What is the CAS number of 2-Propanesulfonamide,n-(2,3-dihydro-1h-indol-5-yl)? |
| A: CAS number of 2-Propanesulfonamide,n-(2,3-dihydro-1h-indol-5-yl) is 1182879-75-9. |