2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxo-3-(1-phenylethoxy)propanoate
![2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxo-3-(1-phenylethoxy)propanoate Structure](https://image.chemsrc.com/caspic/225/118317-76-3.png)
2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxo-3-(1-phenylethoxy)propanoate structure
|
Common Name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxo-3-(1-phenylethoxy)propanoate | ||
|---|---|---|---|---|
| CAS Number | 118317-76-3 | Molecular Weight | 323.34 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H21NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxo-3-(1-phenylethoxy)propanoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H21NO6 |
|---|---|
| Molecular Weight | 323.34 |
| Exact Mass | 323.13688739 |
| PSA | 108.25000 |
| LogP | 1.13840 |
| InChIKey | JWBKYRCKYNMJBK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C(=O)OC)C(=O)OCC1=CC=CC=C1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2-[(2-methylpro... CAS#:118317-76-3 |
| Literature: Matt, Thomas; Seebach, Dieter Helvetica Chimica Acta, 1998 , vol. 81, # 10 p. 1845 - 1895 |
![Benzyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate structure](https://image.chemsrc.com/caspic/488/54244-69-8.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 1 | |
CAS#:119881-02-6This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| BOC-aminomalonic acid |
| methyl benzyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxo-3-(1-phenylethoxy)propanoate have? |
| A: English synonyms of 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxo-3-(1-phenylethoxy)propanoate: BOC-aminomalonic acid, methyl benzyl ester. |
| Q: What is the molecular weight of 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxo-3-(1-phenylethoxy)propanoate? |
| A: Molecular weight of 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxo-3-(1-phenylethoxy)propanoate is 323.34. |
| Q: What is the Chinese name of 118317-76-3? |
| A: Chinese name of 118317-76-3 is 118317-76-3. |
| Q: What is the SMILES notation of 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxo-3-(1-phenylethoxy)propanoate? |
| A: SMILES notation of 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxo-3-(1-phenylethoxy)propanoate is CC(C)(C)OC(=O)NC(C(=O)OC)C(=O)OCC1=CC=CC=C1. |
| Q: What is the CAS number of 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxo-3-(1-phenylethoxy)propanoate? |
| A: CAS number of 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxo-3-(1-phenylethoxy)propanoate is 118317-76-3. |
| Q: What are the downstream products of 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxo-3-(1-phenylethoxy)propanoate? |
| A: Related downstream products(CAS) of 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxo-3-(1-phenylethoxy)propanoate: 119881-02-6. |
| Q: What are the upstream materials of 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxo-3-(1-phenylethoxy)propanoate? |
| A: Related upstream materials(CAS) of 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxo-3-(1-phenylethoxy)propanoate: 54244-69-8. |
| Q: What is the InChIKey of 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxo-3-(1-phenylethoxy)propanoate? |
| A: InChIKey of 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxo-3-(1-phenylethoxy)propanoate is JWBKYRCKYNMJBK-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxo-3-(1-phenylethoxy)propanoate? |
| A: Molecular formula of 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxo-3-(1-phenylethoxy)propanoate is C16H21NO6. |
| Q: What is the English name of 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxo-3-(1-phenylethoxy)propanoate? |
| A: The English name of 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxo-3-(1-phenylethoxy)propanoate is 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxo-3-(1-phenylethoxy)propanoate. |