2’-OTBDMS-rU structure
|
Common Name | 2’-OTBDMS-rU | ||
|---|---|---|---|---|
| CAS Number | 118362-03-1 | Molecular Weight | 861.05 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C45H61N4O9PSi | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
Use of 2’-OTBDMS-rUrU Phosphoramidite is a phosphorite monomer that can be used in the synthesis of oligonucleotides. |
| Name | 3-[[(2R,3R,4R,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[tert-butyl(dimethyl)silyl]oxy-5-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
|---|---|
| Synonym | More Synonyms |
| Description | rU Phosphoramidite is a phosphorite monomer that can be used in the synthesis of oligonucleotides. |
|---|---|
| Related Catalog |
| Molecular Formula | C45H61N4O9PSi |
|---|---|
| Molecular Weight | 861.05 |
| Exact Mass | 860.394531 |
| PSA | 160.09000 |
| LogP | 10.61 |
| InChIKey | SKNLXHRBXYGJOC-ZMHKPELYSA-N |
| SMILES | COc1ccc(C(OCC2OC(n3ccc(=O)[nH]c3=O)C(O[Si](C)(C)C(C)(C)C)C2OP(OCCC#N)N(C(C)C)C(C)C)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| rU Phosphoramidite |
| 2'-O-tertbutyldimethylsilyl-uridine O3'-phosphoramidite |
| 2'-O-tert-butyldimethylsilyl-5'-O-dimethoxytrityluridine 2-cyanoethyl-N,N-diisopropylphosphoramidite |
| Uridine, 5'-O-[bis(4-methoxyphenyl)phenylmethyl]-3'-O-[[bis(1-methylethyl)amino](2-cyanoethoxy)phosphino]-2'-O-[(1,1-dimethylethyl)dimethylsilyl]- |
| rUPhosphoramidite |
| 5'-O-[Bis(4-methoxyphenyl)(phenyl)methyl]-3'-O-[(2-cyanoethoxy)(diisopropylamino)phosphino]-2'-O-[dimethyl(2-methyl-2-propanyl)silyl]uridine |
| 2’-OTBDMS-rU |