MK886 structure
|
Common Name | MK886 | ||
|---|---|---|---|---|
| CAS Number | 118414-82-7 | Molecular Weight | 472.08 | |
| Density | 1.14g/cm3 | Boiling Point | 623.4ºC at 760mmHg | |
| Molecular Formula | C27H34ClNO2S | Melting Point | 295-297ºC | |
| MSDS | N/A | Flash Point | 330.8ºC | |
Use of MK886MK886 is a 5-lipoxygenase-activating protein inhibitor and a leukotriene biosynthesis inhibitor (IC50=2.5 nM). |
| Name | 3-[3-tert-butylsulfanyl-1-[(4-chlorophenyl)methyl]-5-propan-2-ylindol-2-yl]-2,2-dimethylpropanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | MK886 is a 5-lipoxygenase-activating protein inhibitor and a leukotriene biosynthesis inhibitor (IC50=2.5 nM). |
|---|---|
| Related Catalog | |
| References |
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 623.4ºC at 760mmHg |
| Melting Point | 295-297ºC |
| Molecular Formula | C27H34ClNO2S |
| Molecular Weight | 472.08 |
| Flash Point | 330.8ºC |
| PSA | 70.36000 |
| LogP | 6.67560 |
| Vapour Pressure | 2.11E-16mmHg at 25°C |
| Index of Refraction | 1.58 |
| InChIKey | QAOAOVKBIIKRNL-UHFFFAOYSA-N |
| SMILES | CC(C)c1ccc2c(c1)c(SC(C)(C)C)c(CC(C)(C)C(=O)O)n2Cc1ccc(Cl)cc1 |
| Storage condition | -20℃ |
| WGK Germany | 3 |
|---|
| Sodium 3-[3-(tert-butylsulfanyl)-1-(4-chlorobenzyl)-5-isopropyl-1H-indol-2-yl]-2,2-dimethylpropanoate |
| 1H-Indole-2-propanoic acid, 1-[(4-chlorophenyl)methyl]-3-[(1,1-dimethylethyl)thio]-α,α-dimethyl-5-(1-methylethyl)-, sodium salt (1:1) |
| Pizotifenum |
| Pizotifene |
| SIN-1 chloride |
| PIZOTYLINE |
| Sandomygran |
| BC-105 |
| Pizotifeno |
| Litec |
| Pizotifen |
| Sandomigran |
| Polomigran |
| Sodium 3-{1-(4-chlorobenzyl)-5-isopropyl-3-[(2-methyl-2-propanyl)sulfanyl]-1H-indol-2-yl}-2,2-dimethylpropanoate |
| MK-886 |