4-(4-(1-Methyl-1H-1,2,4-triazol-3-yl)phenyl)-1,2,3,6-tetrahydropyridine
Modify Date: 2025-09-22 11:47:51
4-(4-(1-Methyl-1H-1,2,4-triazol-3-yl)phenyl)-1,2,3,6-tetrahydropyridine structure
|
Common Name | 4-(4-(1-Methyl-1H-1,2,4-triazol-3-yl)phenyl)-1,2,3,6-tetrahydropyridine | ||
|---|---|---|---|---|
| CAS Number | 1184296-85-2 | Molecular Weight | 240.30 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H16N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(4-(1-Methyl-1H-1,2,4-triazol-3-yl)phenyl)-1,2,3,6-tetrahydropyridine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H16N4 |
|---|---|
| Molecular Weight | 240.30 |
| InChIKey | OWJDWSBMXAMPBY-UHFFFAOYSA-N |
| SMILES | Cn1cnc(-c2ccc(C3=CCNCC3)cc2)n1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1184296-85-2? |
| A: Chinese name of 1184296-85-2 is 1184296-85-2. |
| Q: What is the SMILES notation of 4-(4-(1-Methyl-1H-1,2,4-triazol-3-yl)phenyl)-1,2,3,6-tetrahydropyridine? |
| A: SMILES notation of 4-(4-(1-Methyl-1H-1,2,4-triazol-3-yl)phenyl)-1,2,3,6-tetrahydropyridine is Cn1cnc(-c2ccc(C3=CCNCC3)cc2)n1. |
| Q: What is the English name of 4-(4-(1-Methyl-1H-1,2,4-triazol-3-yl)phenyl)-1,2,3,6-tetrahydropyridine? |
| A: The English name of 4-(4-(1-Methyl-1H-1,2,4-triazol-3-yl)phenyl)-1,2,3,6-tetrahydropyridine is 4-(4-(1-Methyl-1H-1,2,4-triazol-3-yl)phenyl)-1,2,3,6-tetrahydropyridine. |
| Q: What is the CAS number of 4-(4-(1-Methyl-1H-1,2,4-triazol-3-yl)phenyl)-1,2,3,6-tetrahydropyridine? |
| A: CAS number of 4-(4-(1-Methyl-1H-1,2,4-triazol-3-yl)phenyl)-1,2,3,6-tetrahydropyridine is 1184296-85-2. |
| Q: What is the InChIKey of 4-(4-(1-Methyl-1H-1,2,4-triazol-3-yl)phenyl)-1,2,3,6-tetrahydropyridine? |
| A: InChIKey of 4-(4-(1-Methyl-1H-1,2,4-triazol-3-yl)phenyl)-1,2,3,6-tetrahydropyridine is OWJDWSBMXAMPBY-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 4-(4-(1-Methyl-1H-1,2,4-triazol-3-yl)phenyl)-1,2,3,6-tetrahydropyridine? |
| A: Molecular formula of 4-(4-(1-Methyl-1H-1,2,4-triazol-3-yl)phenyl)-1,2,3,6-tetrahydropyridine is C14H16N4. |
| Q: What is the molecular weight of 4-(4-(1-Methyl-1H-1,2,4-triazol-3-yl)phenyl)-1,2,3,6-tetrahydropyridine? |
| A: Molecular weight of 4-(4-(1-Methyl-1H-1,2,4-triazol-3-yl)phenyl)-1,2,3,6-tetrahydropyridine is 240.30. |