tributyl-[5-(2-phenylethyl)furan-2-yl]stannane structure
|
Common Name | tributyl-[5-(2-phenylethyl)furan-2-yl]stannane | ||
|---|---|---|---|---|
| CAS Number | 118486-96-7 | Molecular Weight | 461.25900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H38OSn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tributyl-[5-(2-phenylethyl)furan-2-yl]stannane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C24H38OSn |
|---|---|
| Molecular Weight | 461.25900 |
| Exact Mass | 462.19400 |
| PSA | 13.14000 |
| LogP | 7.34600 |
| InChIKey | DSRUFYUWSNLXNR-UHFFFAOYSA-N |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1ccc(CCc2ccccc2)o1 |
|
~74%
tributyl-[5-(2-... CAS#:118486-96-7 |
| Literature: Yamamoto, Makoto; Munakata, Hiroshi; Kishikawa, Keiki; Kohmoto, Shigeo; Yamada, Kazutoshi Bulletin of the Chemical Society of Japan, 1992 , vol. 65, # 9 p. 2366 - 2370 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-phenethyl-5-tributylstannylfuran |
| 2-phenylethyl-5-tributylstannylfuran |