Acetic acid,tris(1-methylethyl)germyl ester structure
|
Common Name | Acetic acid,tris(1-methylethyl)germyl ester | ||
|---|---|---|---|---|
| CAS Number | 1185-37-1 | Molecular Weight | 260.94700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H24GeO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tri(propan-2-yl)germyl acetate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H24GeO2 |
|---|---|
| Molecular Weight | 260.94700 |
| Exact Mass | 262.09900 |
| PSA | 26.30000 |
| LogP | 3.72500 |
| InChIKey | CHSYDTNQURBORV-UHFFFAOYSA-N |
| SMILES | CC(=O)O[Ge](C(C)C)(C(C)C)C(C)C |
| HS Code | 2915299090 |
|---|
|
~%
Acetic acid,tri... CAS#:1185-37-1 |
| Literature: Anderson Journal of Organic Chemistry, 1955 , vol. 20, p. 536,538 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2915299090 |
|---|---|
| Summary | 2915299090 salts of acetic acid。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:5.5%。general tariff:50.0% |
| Triisopropyl-germanium(1+),Acetat |
| Germane,(acetyloxy)tris(1-methylethyl) |
| triisopropyl germanium (1+),acetate |
| Acetoxy-triisopropyl-german |