amino(triethyl)azanium,nitrate structure
|
Common Name | amino(triethyl)azanium,nitrate | ||
|---|---|---|---|---|
| CAS Number | 1185-49-5 | Molecular Weight | 179.21700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H17N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | amino(triethyl)azanium,nitrate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6H17N3O3 |
|---|---|
| Molecular Weight | 179.21700 |
| Exact Mass | 179.12700 |
| PSA | 94.90000 |
| LogP | 1.72100 |
| InChIKey | BXJNJJUJVFXPKI-UHFFFAOYSA-N |
| SMILES | CC[N+](N)(CC)CC.O=[N+]([O-])[O-] |
| HS Code | 2928000090 |
|---|
|
~90%
amino(triethyl)... CAS#:1185-49-5 |
| Literature: Olah, George A.; Sassaman, Mark B.; Zuanic, Miljenko; Rao, Chandra B.; Prakash, G. K. Surya; et al. Journal of Organic Chemistry, 1992 , vol. 57, # 5 p. 1585 - 1588 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 1,1,1-Triethylhydrazinium nitrate |
| N,N,N-triethyl-hydrazinium,nitrate |
| Hydrazinium,1,1,1-triethyl-,nitrate |
| N,N,N-Triaethyl-hydrazinium,Nitrat |