Lumefantrine D18 structure
|
Common Name | Lumefantrine D18 | ||
|---|---|---|---|---|
| CAS Number | 1185240-53-2 | Molecular Weight | 547.05 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C30H14D18Cl3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Lumefantrine D18Lumefantrine D18 is the deuterium labeled Lumefantrine, which is an antimalarial drug. |
| Name | 2-{Bis[(2H9)butyl]amino}-1-[(9E)-2,7-dichloro-9-(4-chlorobenzylidene)-9H-fluoren-4-yl]ethanol |
|---|---|
| Synonym | More Synonyms |
| Description | Lumefantrine D18 is the deuterium labeled Lumefantrine, which is an antimalarial drug. |
|---|---|
| Related Catalog |
| Molecular Formula | C30H14D18Cl3NO |
|---|---|
| Molecular Weight | 547.05 |
| PSA | 23.47000 |
| LogP | 9.15170 |
| InChIKey | DYLGFOYVTXJFJP-OASVJRPASA-N |
| SMILES | CCCCN(CCCC)CC(O)c1cc(Cl)cc2c1-c1ccc(Cl)cc1C2=Cc1ccc(Cl)cc1 |
| Storage condition | 2-8℃ |
| Lumefantrine-d18 |
| Lumefantrine D18 |