1,2-Diethyl-1h-benzoimidazol-5-ylamine dihydrochloride
Modify Date: 2026-07-03 13:32:07
1,2-Diethyl-1h-benzoimidazol-5-ylamine dihydrochloride structure
|
Common Name | 1,2-Diethyl-1h-benzoimidazol-5-ylamine dihydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1185293-92-8 | Molecular Weight | 262.18 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H17Cl2N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,2-Diethyl-1h-benzoimidazol-5-ylamine dihydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H17Cl2N3 |
|---|---|
| Molecular Weight | 262.18 |
| InChIKey | GYOGPDIGHQEFNQ-UHFFFAOYSA-N |
| SMILES | CCc1nc2cc(N)ccc2n1CC.Cl.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1185293-92-8? |
| A: Chinese name of 1185293-92-8 is 1185293-92-8. |
| Q: What is the molecular weight of 1,2-Diethyl-1h-benzoimidazol-5-ylamine dihydrochloride? |
| A: Molecular weight of 1,2-Diethyl-1h-benzoimidazol-5-ylamine dihydrochloride is 262.18. |
| Q: What is the SMILES notation of 1,2-Diethyl-1h-benzoimidazol-5-ylamine dihydrochloride? |
| A: SMILES notation of 1,2-Diethyl-1h-benzoimidazol-5-ylamine dihydrochloride is CCc1nc2cc(N)ccc2n1CC.Cl.Cl. |
| Q: What is the English name of 1,2-Diethyl-1h-benzoimidazol-5-ylamine dihydrochloride? |
| A: The English name of 1,2-Diethyl-1h-benzoimidazol-5-ylamine dihydrochloride is 1,2-Diethyl-1h-benzoimidazol-5-ylamine dihydrochloride. |
| Q: What is the CAS number of 1,2-Diethyl-1h-benzoimidazol-5-ylamine dihydrochloride? |
| A: CAS number of 1,2-Diethyl-1h-benzoimidazol-5-ylamine dihydrochloride is 1185293-92-8. |
| Q: What is the InChIKey of 1,2-Diethyl-1h-benzoimidazol-5-ylamine dihydrochloride? |
| A: InChIKey of 1,2-Diethyl-1h-benzoimidazol-5-ylamine dihydrochloride is GYOGPDIGHQEFNQ-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 1,2-Diethyl-1h-benzoimidazol-5-ylamine dihydrochloride? |
| A: Molecular formula of 1,2-Diethyl-1h-benzoimidazol-5-ylamine dihydrochloride is C11H17Cl2N3. |