2-(trifluoromethyl)--1H-Pyrrolo[2,3-b]pyridin-5-amine structure
|
Common Name | 2-(trifluoromethyl)--1H-Pyrrolo[2,3-b]pyridin-5-amine | ||
|---|---|---|---|---|
| CAS Number | 1186502-40-8 | Molecular Weight | 353.412 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 426.6±30.0 °C at 760 mmHg | |
| Molecular Formula | C21H23NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211.8±24.6 °C | |
| Name | 2-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridin-5-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 426.6±30.0 °C at 760 mmHg |
| Molecular Formula | C21H23NO4 |
| Molecular Weight | 353.412 |
| Flash Point | 211.8±24.6 °C |
| Exact Mass | 353.162720 |
| PSA | 54.70000 |
| LogP | 2.86 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.573 |
| InChIKey | CEANZCNGGYHXCA-UHFFFAOYSA-N |
| SMILES | Nc1cnc2[nH]c(C(F)(F)F)cc2c1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Propanedioic acid, 2-[1-(diphenylmethyl)-3-azetidinyl]-, dimethyl ester |
| Dimethyl [1-(diphenylmethyl)-3-azetidinyl]malonate |
| qc-4365 |
| 2-(trifluoromethyl)--1H-Pyrrolo[2,3-b]pyridin-5-amine |