5-broMo-3-(4-Methoxyphenyl)-1-phenyl-1H-pyrazole-4-carbaldehyde structure
|
Common Name | 5-broMo-3-(4-Methoxyphenyl)-1-phenyl-1H-pyrazole-4-carbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 1188037-01-5 | Molecular Weight | 357.201 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 496.3±45.0 °C at 760 mmHg | |
| Molecular Formula | C17H13BrN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 254.0±28.7 °C | |
| Name | 5-Bromo-3-(4-methoxyphenyl)-1-phenyl-1H-pyrazole-4-carbaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 496.3±45.0 °C at 760 mmHg |
| Molecular Formula | C17H13BrN2O2 |
| Molecular Weight | 357.201 |
| Flash Point | 254.0±28.7 °C |
| Exact Mass | 356.016022 |
| PSA | 44.12000 |
| LogP | 4.65 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.633 |
| InChIKey | OEMWMRNELHHBMB-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2nn(-c3ccccc3)c(Br)c2C=O)cc1 |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-bromo-3-(4-methoxyphenyl)-1-phenylpyrazole-4-carbaldehyde |
| 1H-Pyrazole-4-carboxaldehyde, 5-bromo-3-(4-methoxyphenyl)-1-phenyl- |
| 5-Bromo-3-(4-methoxyphenyl)-1-phenyl-1H-pyrazole-4-carbaldehyde |