4-methoxy-2,5-bis(methoxymethoxy)-3-methylaniline structure
|
Common Name | 4-methoxy-2,5-bis(methoxymethoxy)-3-methylaniline | ||
|---|---|---|---|---|
| CAS Number | 118825-02-8 | Molecular Weight | 257.28300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H19NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-methoxy-2,5-bis(methoxymethoxy)-3-methylaniline |
|---|
| Molecular Formula | C12H19NO5 |
|---|---|
| Molecular Weight | 257.28300 |
| Exact Mass | 257.12600 |
| PSA | 72.17000 |
| LogP | 2.13240 |
| InChIKey | LCXDIYAFJHQOHR-UHFFFAOYSA-N |
| SMILES | COCOc1cc(N)c(OCOC)c(C)c1OC |
|
~99%
4-methoxy-2,5-b... CAS#:118825-02-8 |
| Literature: Raphael, Ralph A.; Ravenscroft, Paul Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1988 , p. 1823 - 1828 |
|
~%
4-methoxy-2,5-b... CAS#:118825-02-8 |
| Literature: Raphael, Ralph A.; Ravenscroft, Paul Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1988 , p. 1823 - 1828 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |