tert-butyl 3-(2-hydroxyethyl)piperazine-1-carboxylate
Modify Date: 2025-08-25 19:20:55
tert-butyl 3-(2-hydroxyethyl)piperazine-1-carboxylate structure
|
Common Name | tert-butyl 3-(2-hydroxyethyl)piperazine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 1188265-73-7 | Molecular Weight | 230.304 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 352.2±22.0 °C at 760 mmHg | |
| Molecular Formula | C11H22N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 166.8±22.3 °C | |
| Name | tert-butyl 3-(2-hydroxyethyl)piperazine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 352.2±22.0 °C at 760 mmHg |
| Molecular Formula | C11H22N2O3 |
| Molecular Weight | 230.304 |
| Flash Point | 166.8±22.3 °C |
| Exact Mass | 230.163040 |
| PSA | 61.80000 |
| LogP | 0.75 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.478 |
| InChIKey | FPQSSQQQKLJLPA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCNC(CCO)C1 |
| HS Code | 2933599090 |
|---|
|
~%
tert-butyl 3-(2... CAS#:1188265-73-7 |
| Literature: MERCK SHARP and DOHME CORP.; PASTERNAK, Alexander; BLIZZARD, Timothy; CHOBANIAN, Harry; DE JESUS, Reynalda; DING, Fa-Xiang; DONG, Shuzhi; GUDE, Candido; KIM, Dooseop; TANG, Haifeng; WALSH, Shawn; PIO, Barbara; JIANG, Jinlong Patent: WO2013/28474 A1, 2013 ; Location in patent: Page/Page column 49 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| as-p1 |
| tert-Butyl 3-(2-hydroxyethyl)piperazine-1-carboxylate |
| 2-Methyl-2-propanyl 3-(2-hydroxyethyl)-1-piperazinecarboxylate |
| 1-Piperazinecarboxylic acid, 3-(2-hydroxyethyl)-, 1,1-dimethylethyl ester |