(E)-Methyl 5-((tert-butoxycarbonyl)amino)-2-((dimethylamino)methylene)-3-oxopentanoate
Modify Date: 2026-08-05 23:40:31
(E)-Methyl 5-((tert-butoxycarbonyl)amino)-2-((dimethylamino)methylene)-3-oxopentanoate structure
|
Common Name | (E)-Methyl 5-((tert-butoxycarbonyl)amino)-2-((dimethylamino)methylene)-3-oxopentanoate | ||
|---|---|---|---|---|
| CAS Number | 1188338-53-5 | Molecular Weight | 300.35 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H24N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (E)-Methyl 5-((tert-butoxycarbonyl)amino)-2-((dimethylamino)methylene)-3-oxopentanoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H24N2O5 |
|---|---|
| Molecular Weight | 300.35 |
| InChIKey | CDRASZCVCBZSIR-MDZDMXLPSA-N |
| SMILES | COC(=O)C(=CN(C)C)C(=O)CCNC(=O)OC(C)(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of (E)-Methyl 5-((tert-butoxycarbonyl)amino)-2-((dimethylamino)methylene)-3-oxopentanoate? |
| A: Molecular weight of (E)-Methyl 5-((tert-butoxycarbonyl)amino)-2-((dimethylamino)methylene)-3-oxopentanoate is 300.35. |
| Q: What is the molecular formula of (E)-Methyl 5-((tert-butoxycarbonyl)amino)-2-((dimethylamino)methylene)-3-oxopentanoate? |
| A: Molecular formula of (E)-Methyl 5-((tert-butoxycarbonyl)amino)-2-((dimethylamino)methylene)-3-oxopentanoate is C14H24N2O5. |
| Q: What is the SMILES notation of (E)-Methyl 5-((tert-butoxycarbonyl)amino)-2-((dimethylamino)methylene)-3-oxopentanoate? |
| A: SMILES notation of (E)-Methyl 5-((tert-butoxycarbonyl)amino)-2-((dimethylamino)methylene)-3-oxopentanoate is COC(=O)C(=CN(C)C)C(=O)CCNC(=O)OC(C)(C)C. |
| Q: What is the CAS number of (E)-Methyl 5-((tert-butoxycarbonyl)amino)-2-((dimethylamino)methylene)-3-oxopentanoate? |
| A: CAS number of (E)-Methyl 5-((tert-butoxycarbonyl)amino)-2-((dimethylamino)methylene)-3-oxopentanoate is 1188338-53-5. |
| Q: What is the Chinese name of 1188338-53-5? |
| A: Chinese name of 1188338-53-5 is 1188338-53-5. |
| Q: What is the English name of (E)-Methyl 5-((tert-butoxycarbonyl)amino)-2-((dimethylamino)methylene)-3-oxopentanoate? |
| A: The English name of (E)-Methyl 5-((tert-butoxycarbonyl)amino)-2-((dimethylamino)methylene)-3-oxopentanoate is (E)-Methyl 5-((tert-butoxycarbonyl)amino)-2-((dimethylamino)methylene)-3-oxopentanoate. |
| Q: What is the InChIKey of (E)-Methyl 5-((tert-butoxycarbonyl)amino)-2-((dimethylamino)methylene)-3-oxopentanoate? |
| A: InChIKey of (E)-Methyl 5-((tert-butoxycarbonyl)amino)-2-((dimethylamino)methylene)-3-oxopentanoate is CDRASZCVCBZSIR-MDZDMXLPSA-N. |