4-methyl-N-(2,3,4,5,6-pentafluorophenyl)benzenesulfonamide structure
|
Common Name | 4-methyl-N-(2,3,4,5,6-pentafluorophenyl)benzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 118841-85-3 | Molecular Weight | 337.26500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H8F5NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-methyl-N-(2,3,4,5,6-pentafluorophenyl)benzenesulfonamide |
|---|
| Molecular Formula | C13H8F5NO2S |
|---|---|
| Molecular Weight | 337.26500 |
| Exact Mass | 337.02000 |
| PSA | 54.55000 |
| LogP | 4.64510 |
| InChIKey | LEEPUQTWJJTHMX-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)Nc2c(F)c(F)c(F)c(F)c2F)cc1 |
| HS Code | 2935009090 |
|---|
|
~%
4-methyl-N-(2,3... CAS#:118841-85-3 |
| Literature: Dai, Hui-Xiong; Stepan, Antonia F.; Plummer, Mark S.; Zhang, Yang-Hui; Yu, Jin-Quan Journal of the American Chemical Society, 2011 , vol. 133, # 18 p. 7222 - 7228 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |