N-isopropyl-3-amino-2-(3,4-dihydroxyphenyl)-2-hydroxybicyclo(2.2.1)heptane structure
|
Common Name | N-isopropyl-3-amino-2-(3,4-dihydroxyphenyl)-2-hydroxybicyclo(2.2.1)heptane | ||
|---|---|---|---|---|
| CAS Number | 118891-95-5 | Molecular Weight | 277.35900 | |
| Density | 1.26g/cm3 | Boiling Point | 473.4ºC at 760mmHg | |
| Molecular Formula | C16H23NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 163.6ºC | |
| Name | 4-[3-hydroxy-2-(propan-2-ylamino)-3-bicyclo[2.2.1]heptanyl]benzene-1,2-diol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 473.4ºC at 760mmHg |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.35900 |
| Flash Point | 163.6ºC |
| Exact Mass | 277.16800 |
| PSA | 72.72000 |
| LogP | 2.47280 |
| Vapour Pressure | 9.06E-10mmHg at 25°C |
| Index of Refraction | 1.623 |
| InChIKey | KEUBXSDYVDQAIJ-UHFFFAOYSA-N |
| SMILES | CC(C)NC1C2CCC(C2)C1(O)c1ccc(O)c(O)c1 |
|
~%
N-isopropyl-3-a... CAS#:118891-95-5 |
| Literature: Balsamo, A.; Breschi, M. C.; Lapucci, A.; Macchia, B.; Macchia, F.; et al. Journal of Medicinal Chemistry, 1989 , vol. 32, # 4 p. 856 - 859 |
|
~%
N-isopropyl-3-a... CAS#:118891-95-5 |
| Literature: Journal of Medicinal Chemistry, , vol. 32, # 4 p. 856 - 859 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1,2-Benzenediol,4-[2-hydroxy-3-[(1-methylethyl)amino]bicyclo[2.2.1]hept-2-yl]-,(endo,endo)-(9CI) |
| N-Iadhh |
| exo-2-(3,4-dihydroxyphenyl)-2-hydroxy-endo-3-(isopropylamino)bicyclo[2.2.1]heptane |
| N-ISOPROPYL-3-AMINO-2-(3,4-DIHYDROXYPHENYL)-2-HYDROXYBICYCLO[2.2.1]HEPTANE |