3',5'-Difluoro-4'-(trifluoromethyl)acetophenone structure
|
Common Name | 3',5'-Difluoro-4'-(trifluoromethyl)acetophenone | ||
|---|---|---|---|---|
| CAS Number | 1189359-39-4 | Molecular Weight | 224.127 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 232.1±40.0 °C at 760 mmHg | |
| Molecular Formula | C9H5F5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 87.8±21.5 °C | |
| Name | 1-[3,5-Difluoro-4-(trifluoromethyl)phenyl]ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 232.1±40.0 °C at 760 mmHg |
| Molecular Formula | C9H5F5O |
| Molecular Weight | 224.127 |
| Flash Point | 87.8±21.5 °C |
| Exact Mass | 224.026062 |
| PSA | 17.07000 |
| LogP | 2.92 |
| Vapour Pressure | 0.1±0.5 mmHg at 25°C |
| Index of Refraction | 1.420 |
| InChIKey | RALJIWTUZNHFGT-UHFFFAOYSA-N |
| SMILES | CC(=O)c1cc(F)c(C(F)(F)F)c(F)c1 |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 1-(3,5-Difluoro-4-(trifluoromethyl)phenyl)ethanone |
| 3',5'-Difluoro-4'-(trifluoromethyl)acetophenone |
| Ethanone, 1-[3,5-difluoro-4-(trifluoromethyl)phenyl]- |
| 1-[3,5-Difluoro-4-(trifluoromethyl)phenyl]ethanone |
| TD1078 |